C20H35ClN2O4 — CID 21124995
(2-heptoxyphenyl)carbamic acid;2-pyrrolidin-1-ylethanol;hydrochloride (PubChem CID 21124995) has the molecular formula C20H35ClN2O4 and a molecular weight of 402.96 g/mol. Its IUPAC name is (2-heptoxyphenyl)carbamic acid;2-pyrrolidin-1-ylethanol;hydrochloride.
| Compound Name | (2-heptoxyphenyl)carbamic acid;2-pyrrolidin-1-ylethanol;hydrochloride |
|---|---|
| PubChem CID | 21124995 |
| Molecular Formula | C20H35ClN2O4 |
| Molecular Weight | 402.96 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | (2-heptoxyphenyl)carbamic acid;2-pyrrolidin-1-ylethanol;hydrochloride |
| SMILES | CCCCCCCOc1ccccc1NC(=O)O.Cl.OCCN1CCCC1 |
| InChI | InChI=1S/C14H21NO3.C6H13NO.ClH/c1-2-3-4-5-8-11-18-13-10-7-6-9-12(13)15-14(16)17;8-6-5-7-3-1-2-4-7;/h6-7,9-10,15H,2-5,8,11H2,1H3,(H,16,17);8H,1-6H2;1H |
| InChIKey | AUBXFRIGELGJJZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.96 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|