C21H35N3O3 — CID 24836479
2-(4-methylpiperazin-1-yl)ethyl N-(2-heptoxyphenyl)carbamate (PubChem CID 24836479) has the molecular formula C21H35N3O3 and a molecular weight of 377.53 g/mol. Its IUPAC name is 2-(4-methylpiperazin-1-yl)ethyl N-(2-heptoxyphenyl)carbamate.
| Compound Name | 2-(4-methylpiperazin-1-yl)ethyl N-(2-heptoxyphenyl)carbamate |
|---|---|
| PubChem CID | 24836479 |
| Molecular Formula | C21H35N3O3 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | 2-(4-methylpiperazin-1-yl)ethyl N-(2-heptoxyphenyl)carbamate |
| SMILES | CCCCCCCOc1ccccc1NC(=O)OCCN1CCN(C)CC1 |
| InChI | InChI=1S/C21H35N3O3/c1-3-4-5-6-9-17-26-20-11-8-7-10-19(20)22-21(25)27-18-16-24-14-12-23(2)13-15-24/h7-8,10-11H,3-6,9,12-18H2,1-2H3,(H,22,25) |
| InChIKey | OWNMGHFEIJDLLG-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|