C26H45Cl2N3O3 — CID 3087312
1,3-di(piperidin-1-yl)propan-2-yl N-(2-hexoxyphenyl)carbamate;dihydrochloride (PubChem CID 3087312) has the molecular formula C26H45Cl2N3O3 and a molecular weight of 518.57 g/mol. Its IUPAC name is 1,3-di(piperidin-1-yl)propan-2-yl N-(2-hexoxyphenyl)carbamate;dihydrochloride.
| Compound Name | 1,3-di(piperidin-1-yl)propan-2-yl N-(2-hexoxyphenyl)carbamate;dihydrochloride |
|---|---|
| PubChem CID | 3087312 |
| Molecular Formula | C26H45Cl2N3O3 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | 1,3-di(piperidin-1-yl)propan-2-yl N-(2-hexoxyphenyl)carbamate;dihydrochloride |
| SMILES | CCCCCCOc1ccccc1NC(=O)OC(CN1CCCCC1)CN1CCCCC1.Cl.Cl |
| InChI | InChI=1S/C26H43N3O3.2ClH/c1-2-3-4-13-20-31-25-15-8-7-14-24(25)27-26(30)32-23(21-28-16-9-5-10-17-28)22-29-18-11-6-12-19-29;;/h7-8,14-15,23H,2-6,9-13,16-22H2,1H3,(H,27,30);2*1H |
| InChIKey | VXXCMANOWYYYCV-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|