C24H38N2O9 — CID 24836159
[1-(2-ethoxyethoxy)-3-pyrrolidin-1-ylpropan-2-yl] N-(2-butoxyphenyl)carbamate;oxalic acid (PubChem CID 24836159) has the molecular formula C24H38N2O9 and a molecular weight of 498.57 g/mol. Its IUPAC name is [1-(2-ethoxyethoxy)-3-pyrrolidin-1-ylpropan-2-yl] N-(2-butoxyphenyl)carbamate;oxalic acid.
| Compound Name | [1-(2-ethoxyethoxy)-3-pyrrolidin-1-ylpropan-2-yl] N-(2-butoxyphenyl)carbamate;oxalic acid |
|---|---|
| PubChem CID | 24836159 |
| Molecular Formula | C24H38N2O9 |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | [1-(2-ethoxyethoxy)-3-pyrrolidin-1-ylpropan-2-yl] N-(2-butoxyphenyl)carbamate;oxalic acid |
| SMILES | CCCCOc1ccccc1NC(=O)OC(COCCOCC)CN1CCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H36N2O5.C2H2O4/c1-3-5-14-28-21-11-7-6-10-20(21)23-22(25)29-19(17-24-12-8-9-13-24)18-27-16-15-26-4-2;3-1(4)2(5)6/h6-7,10-11,19H,3-5,8-9,12-18H2,1-2H3,(H,23,25);(H,3,4)(H,5,6) |
| InChIKey | VAJZXQZWJCRXKV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|