C21H36N2O4 — CID 10619789
[1-butoxy-3-(diethylamino)propan-2-yl] N-(2-propoxyphenyl)carbamate (PubChem CID 10619789) has the molecular formula C21H36N2O4 and a molecular weight of 380.53 g/mol. Its IUPAC name is [1-butoxy-3-(diethylamino)propan-2-yl] N-(2-propoxyphenyl)carbamate.
| Compound Name | [1-butoxy-3-(diethylamino)propan-2-yl] N-(2-propoxyphenyl)carbamate |
|---|---|
| PubChem CID | 10619789 |
| Molecular Formula | C21H36N2O4 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | [1-butoxy-3-(diethylamino)propan-2-yl] N-(2-propoxyphenyl)carbamate |
| SMILES | CCCCOCC(CN(CC)CC)OC(=O)Nc1ccccc1OCCC |
| InChI | InChI=1S/C21H36N2O4/c1-5-9-15-25-17-18(16-23(7-3)8-4)27-21(24)22-19-12-10-11-13-20(19)26-14-6-2/h10-13,18H,5-9,14-17H2,1-4H3,(H,22,24) |
| InChIKey | MYDWLUGBDOZCNU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|