C25H45ClN2O4 — CID 24836225
[1-butoxy-3-(diethylamino)propan-2-yl] N-(2-heptoxyphenyl)carbamate;hydrochloride (PubChem CID 24836225) has the molecular formula C25H45ClN2O4 and a molecular weight of 473.10 g/mol. Its IUPAC name is [1-butoxy-3-(diethylamino)propan-2-yl] N-(2-heptoxyphenyl)carbamate;hydrochloride.
| Compound Name | [1-butoxy-3-(diethylamino)propan-2-yl] N-(2-heptoxyphenyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 24836225 |
| Molecular Formula | C25H45ClN2O4 |
| Molecular Weight | 473.10 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | [1-butoxy-3-(diethylamino)propan-2-yl] N-(2-heptoxyphenyl)carbamate;hydrochloride |
| SMILES | CCCCCCCOc1ccccc1NC(=O)OC(COCCCC)CN(CC)CC.Cl |
| InChI | InChI=1S/C25H44N2O4.ClH/c1-5-9-11-12-15-19-30-24-17-14-13-16-23(24)26-25(28)31-22(20-27(7-3)8-4)21-29-18-10-6-2;/h13-14,16-17,22H,5-12,15,18-21H2,1-4H3,(H,26,28);1H |
| InChIKey | WPSDEVHCQNFCOF-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.10 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|