C25H43N3O3 — CID 13127159
[1-(azepan-1-yl)-3-(diethylamino)propan-2-yl] N-(2-pentoxyphenyl)carbamate (PubChem CID 13127159) has the molecular formula C25H43N3O3 and a molecular weight of 433.64 g/mol. Its IUPAC name is [1-(azepan-1-yl)-3-(diethylamino)propan-2-yl] N-(2-pentoxyphenyl)carbamate.
| Compound Name | [1-(azepan-1-yl)-3-(diethylamino)propan-2-yl] N-(2-pentoxyphenyl)carbamate |
|---|---|
| PubChem CID | 13127159 |
| Molecular Formula | C25H43N3O3 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.33 |
| IUPAC Name | [1-(azepan-1-yl)-3-(diethylamino)propan-2-yl] N-(2-pentoxyphenyl)carbamate |
| SMILES | CCCCCOc1ccccc1NC(=O)OC(CN(CC)CC)CN1CCCCCC1 |
| InChI | InChI=1S/C25H43N3O3/c1-4-7-14-19-30-24-16-11-10-15-23(24)26-25(29)31-22(20-27(5-2)6-3)21-28-17-12-8-9-13-18-28/h10-11,15-16,22H,4-9,12-14,17-21H2,1-3H3,(H,26,29) |
| InChIKey | JYBYZBFLUAVXKM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|