C20H33ClN2O3 — CID 138400224
2-(azepan-1-yl)ethyl N-(2-pentoxyphenyl)carbamate;hydrochloride (PubChem CID 138400224) has the molecular formula C20H33ClN2O3 and a molecular weight of 384.95 g/mol. Its IUPAC name is 2-(azepan-1-yl)ethyl N-(2-pentoxyphenyl)carbamate;hydrochloride.
| Compound Name | 2-(azepan-1-yl)ethyl N-(2-pentoxyphenyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 138400224 |
| Molecular Formula | C20H33ClN2O3 |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | 2-(azepan-1-yl)ethyl N-(2-pentoxyphenyl)carbamate;hydrochloride |
| SMILES | CCCCCOc1ccccc1NC(=O)OCCN1CCCCCC1.Cl |
| InChI | InChI=1S/C20H32N2O3.ClH/c1-2-3-10-16-24-19-12-7-6-11-18(19)21-20(23)25-17-15-22-13-8-4-5-9-14-22;/h6-7,11-12H,2-5,8-10,13-17H2,1H3,(H,21,23);1H |
| InChIKey | GBEWKIKGPSNCFQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|