C28H49BrN2O3 — CID 3052810
2-(1-heptylpiperidin-1-ium-1-yl)ethyl N-(2-heptoxyphenyl)carbamate bromide (PubChem CID 3052810) has the molecular formula C28H49BrN2O3 and a molecular weight of 541.62 g/mol. Its IUPAC name is 2-(1-heptylpiperidin-1-ium-1-yl)ethyl N-(2-heptoxyphenyl)carbamate bromide.
| Compound Name | 2-(1-heptylpiperidin-1-ium-1-yl)ethyl N-(2-heptoxyphenyl)carbamate bromide |
|---|---|
| PubChem CID | 3052810 |
| Molecular Formula | C28H49BrN2O3 |
| Molecular Weight | 541.62 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | 2-(1-heptylpiperidin-1-ium-1-yl)ethyl N-(2-heptoxyphenyl)carbamate bromide |
| SMILES | CCCCCCCOc1ccccc1NC(=O)OCC[N+]1(CCCCCCC)CCCCC1.[Br-] |
| InChI | InChI=1S/C28H48N2O3.BrH/c1-3-5-7-9-14-20-30(21-15-11-16-22-30)23-25-33-28(31)29-26-18-12-13-19-27(26)32-24-17-10-8-6-4-2;/h12-13,18-19H,3-11,14-17,20-25H2,1-2H3;1H |
| InChIKey | AWRASFOBXPXEHS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.62 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|