C24H41BrN2O4 — CID 21152851
N-(2-heptoxyphenyl)carbamate;2-(1-prop-2-enylpiperidin-1-ium-1-yl)ethanol;hydrobromide (PubChem CID 21152851) has the molecular formula C24H41BrN2O4 and a molecular weight of 501.51 g/mol. Its IUPAC name is N-(2-heptoxyphenyl)carbamate;2-(1-prop-2-enylpiperidin-1-ium-1-yl)ethanol;hydrobromide.
| Compound Name | N-(2-heptoxyphenyl)carbamate;2-(1-prop-2-enylpiperidin-1-ium-1-yl)ethanol;hydrobromide |
|---|---|
| PubChem CID | 21152851 |
| Molecular Formula | C24H41BrN2O4 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | N-(2-heptoxyphenyl)carbamate;2-(1-prop-2-enylpiperidin-1-ium-1-yl)ethanol;hydrobromide |
| SMILES | Br.C=CC[N+]1(CCO)CCCCC1.CCCCCCCOc1ccccc1NC(=O)[O-] |
| InChI | InChI=1S/C14H21NO3.C10H20NO.BrH/c1-2-3-4-5-8-11-18-13-10-7-6-9-12(13)15-14(16)17;1-2-6-11(9-10-12)7-4-3-5-8-11;/h6-7,9-10,15H,2-5,8,11H2,1H3,(H,16,17);2,12H,1,3-10H2;1H/q;+1;/p-1 |
| InChIKey | MWORQFWMYLBACY-UHFFFAOYSA-M |
| XLogP | 4.53 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|