C23H39N2O3+ — CID 3054187
2-(1-butylpiperidin-1-ium-1-yl)ethyl N-(2-pentoxyphenyl)carbamate (PubChem CID 3054187) has the molecular formula C23H39N2O3+ and a molecular weight of 391.58 g/mol. Its IUPAC name is 2-(1-butylpiperidin-1-ium-1-yl)ethyl N-(2-pentoxyphenyl)carbamate.
| Compound Name | 2-(1-butylpiperidin-1-ium-1-yl)ethyl N-(2-pentoxyphenyl)carbamate |
|---|---|
| PubChem CID | 3054187 |
| Molecular Formula | C23H39N2O3+ |
| Molecular Weight | 391.58 g/mol |
| Exact Mass | 391.30 |
| IUPAC Name | 2-(1-butylpiperidin-1-ium-1-yl)ethyl N-(2-pentoxyphenyl)carbamate |
| SMILES | CCCCCOc1ccccc1NC(=O)OCC[N+]1(CCCC)CCCCC1 |
| InChI | InChI=1S/C23H38N2O3/c1-3-5-12-19-27-22-14-9-8-13-21(22)24-23(26)28-20-18-25(15-6-4-2)16-10-7-11-17-25/h8-9,13-14H,3-7,10-12,15-20H2,1-2H3/p+1 |
| InChIKey | TYYSEZVFPHOTDP-UHFFFAOYSA-O |
| XLogP | 5.60 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.58 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|