C31H55N2O3+ — CID 3052817
2-(1-decylpiperidin-1-ium-1-yl)ethyl N-(2-heptoxyphenyl)carbamate (PubChem CID 3052817) has the molecular formula C31H55N2O3+ and a molecular weight of 503.79 g/mol. Its IUPAC name is 2-(1-decylpiperidin-1-ium-1-yl)ethyl N-(2-heptoxyphenyl)carbamate.
| Compound Name | 2-(1-decylpiperidin-1-ium-1-yl)ethyl N-(2-heptoxyphenyl)carbamate |
|---|---|
| PubChem CID | 3052817 |
| Molecular Formula | C31H55N2O3+ |
| Molecular Weight | 503.79 g/mol |
| Exact Mass | 503.42 |
| IUPAC Name | 2-(1-decylpiperidin-1-ium-1-yl)ethyl N-(2-heptoxyphenyl)carbamate |
| SMILES | CCCCCCCCCC[N+]1(CCOC(=O)Nc2ccccc2OCCCCCCC)CCCCC1 |
| InChI | InChI=1S/C31H54N2O3/c1-3-5-7-9-10-11-12-17-23-33(24-18-14-19-25-33)26-28-36-31(34)32-29-21-15-16-22-30(29)35-27-20-13-8-6-4-2/h15-16,21-22H,3-14,17-20,23-28H2,1-2H3/p+1 |
| InChIKey | BRXFCWNNBXPYDI-UHFFFAOYSA-O |
| XLogP | 8.73 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.79 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|