C22H38BrN2O4- — CID 21152865
N-(2-heptoxyphenyl)carbamate;2-(1-methylpiperidin-1-ium-1-yl)ethanol;bromide (PubChem CID 21152865) has the molecular formula C22H38BrN2O4- and a molecular weight of 474.46 g/mol. Its IUPAC name is N-(2-heptoxyphenyl)carbamate;2-(1-methylpiperidin-1-ium-1-yl)ethanol;bromide.
| Compound Name | N-(2-heptoxyphenyl)carbamate;2-(1-methylpiperidin-1-ium-1-yl)ethanol;bromide |
|---|---|
| PubChem CID | 21152865 |
| Molecular Formula | C22H38BrN2O4- |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-(2-heptoxyphenyl)carbamate;2-(1-methylpiperidin-1-ium-1-yl)ethanol;bromide |
| SMILES | CCCCCCCOc1ccccc1NC(=O)[O-].C[N+]1(CCO)CCCCC1.[Br-] |
| InChI | InChI=1S/C14H21NO3.C8H18NO.BrH/c1-2-3-4-5-8-11-18-13-10-7-6-9-12(13)15-14(16)17;1-9(7-8-10)5-3-2-4-6-9;/h6-7,9-10,15H,2-5,8,11H2,1H3,(H,16,17);10H,2-8H2,1H3;1H/q;+1;/p-2 |
| InChIKey | JDHULXSRDHIAAC-UHFFFAOYSA-L |
| XLogP | 0.40 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|