C30H54BrN2O4- — CID 21152843
N-(2-heptoxyphenyl)carbamate;2-(1-nonylpiperidin-1-ium-1-yl)ethanol;bromide (PubChem CID 21152843) has the molecular formula C30H54BrN2O4- and a molecular weight of 586.68 g/mol. Its IUPAC name is N-(2-heptoxyphenyl)carbamate;2-(1-nonylpiperidin-1-ium-1-yl)ethanol;bromide.
| Compound Name | N-(2-heptoxyphenyl)carbamate;2-(1-nonylpiperidin-1-ium-1-yl)ethanol;bromide |
|---|---|
| PubChem CID | 21152843 |
| Molecular Formula | C30H54BrN2O4- |
| Molecular Weight | 586.68 g/mol |
| Exact Mass | 585.33 |
| IUPAC Name | N-(2-heptoxyphenyl)carbamate;2-(1-nonylpiperidin-1-ium-1-yl)ethanol;bromide |
| SMILES | CCCCCCCCC[N+]1(CCO)CCCCC1.CCCCCCCOc1ccccc1NC(=O)[O-].[Br-] |
| InChI | InChI=1S/C16H34NO.C14H21NO3.BrH/c1-2-3-4-5-6-7-9-12-17(15-16-18)13-10-8-11-14-17;1-2-3-4-5-8-11-18-13-10-7-6-9-12(13)15-14(16)17;/h18H,2-16H2,1H3;6-7,9-10,15H,2-5,8,11H2,1H3,(H,16,17);1H/q+1;;/p-2 |
| InChIKey | RKVOVCPTDAGOIJ-UHFFFAOYSA-L |
| XLogP | 3.53 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.68 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|