C22H37N3O3 — CID 3072265
2-(4-ethylpiperazin-1-yl)ethyl N-(2-heptoxyphenyl)carbamate (PubChem CID 3072265) has the molecular formula C22H37N3O3 and a molecular weight of 391.56 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)ethyl N-(2-heptoxyphenyl)carbamate.
| Compound Name | 2-(4-ethylpiperazin-1-yl)ethyl N-(2-heptoxyphenyl)carbamate |
|---|---|
| PubChem CID | 3072265 |
| Molecular Formula | C22H37N3O3 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.28 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)ethyl N-(2-heptoxyphenyl)carbamate |
| SMILES | CCCCCCCOc1ccccc1NC(=O)OCCN1CCN(CC)CC1 |
| InChI | InChI=1S/C22H37N3O3/c1-3-5-6-7-10-18-27-21-12-9-8-11-20(21)23-22(26)28-19-17-25-15-13-24(4-2)14-16-25/h8-9,11-12H,3-7,10,13-19H2,1-2H3,(H,23,26) |
| InChIKey | CXJRPPGZXMKJFM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|