C27H38N4O4 — CID 10073988
2-[4-[3-(hexanoylamino)phenyl]piperazin-1-yl]ethyl N-(2-ethoxyphenyl)carbamate (PubChem CID 10073988) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is 2-[4-[3-(hexanoylamino)phenyl]piperazin-1-yl]ethyl N-(2-ethoxyphenyl)carbamate.
| Compound Name | 2-[4-[3-(hexanoylamino)phenyl]piperazin-1-yl]ethyl N-(2-ethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 10073988 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 2-[4-[3-(hexanoylamino)phenyl]piperazin-1-yl]ethyl N-(2-ethoxyphenyl)carbamate |
| SMILES | CCCCCC(=O)Nc1cccc(N2CCN(CCOC(=O)Nc3ccccc3OCC)CC2)c1 |
| InChI | InChI=1S/C27H38N4O4/c1-3-5-6-14-26(32)28-22-10-9-11-23(21-22)31-17-15-30(16-18-31)19-20-35-27(33)29-24-12-7-8-13-25(24)34-4-2/h7-13,21H,3-6,14-20H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | FDVRDAPCWVUVGC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|