C33H41N5O5 — CID 10099893
2-[4-[3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]phenyl]piperazin-1-yl]ethyl N-(2-ethoxyphenyl)carbamate (PubChem CID 10099893) has the molecular formula C33H41N5O5 and a molecular weight of 587.72 g/mol. Its IUPAC name is 2-[4-[3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]phenyl]piperazin-1-yl]ethyl N-(2-ethoxyphenyl)carbamate.
| Compound Name | 2-[4-[3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]phenyl]piperazin-1-yl]ethyl N-(2-ethoxyphenyl)carbamate |
|---|---|
| PubChem CID | 10099893 |
| Molecular Formula | C33H41N5O5 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.31 |
| IUPAC Name | 2-[4-[3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]phenyl]piperazin-1-yl]ethyl N-(2-ethoxyphenyl)carbamate |
| SMILES | CCOc1ccccc1NC(=O)OCCN1CCN(c2cccc(C(=O)N3CCN(c4ccc(OC)cc4)CC3)c2)CC1 |
| InChI | InChI=1S/C33H41N5O5/c1-3-42-31-10-5-4-9-30(31)34-33(40)43-24-23-35-15-17-37(18-16-35)28-8-6-7-26(25-28)32(39)38-21-19-36(20-22-38)27-11-13-29(41-2)14-12-27/h4-14,25H,3,15-24H2,1-2H3,(H,34,40) |
| InChIKey | GGBUKKUIALIPMY-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|