C17H28N2O2 — CID 71898997
N-[2-[2-(diethylamino)ethoxy]phenyl]pentanamide (PubChem CID 71898997) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is N-[2-[2-(diethylamino)ethoxy]phenyl]pentanamide.
| Compound Name | N-[2-[2-(diethylamino)ethoxy]phenyl]pentanamide |
|---|---|
| PubChem CID | 71898997 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | N-[2-[2-(diethylamino)ethoxy]phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccccc1OCCN(CC)CC |
| InChI | InChI=1S/C17H28N2O2/c1-4-7-12-17(20)18-15-10-8-9-11-16(15)21-14-13-19(5-2)6-3/h8-11H,4-7,12-14H2,1-3H3,(H,18,20) |
| InChIKey | GZHCCDRTLFIHQB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |