C23H32N2O3 — CID 55580634
N-[2-[2-(diethylamino)ethoxy]phenyl]-3-(2,4-dimethylphenoxy)propanamide (PubChem CID 55580634) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is N-[2-[2-(diethylamino)ethoxy]phenyl]-3-(2,4-dimethylphenoxy)propanamide.
| Compound Name | N-[2-[2-(diethylamino)ethoxy]phenyl]-3-(2,4-dimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 55580634 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | N-[2-[2-(diethylamino)ethoxy]phenyl]-3-(2,4-dimethylphenoxy)propanamide |
| SMILES | CCN(CC)CCOc1ccccc1NC(=O)CCOc1ccc(C)cc1C |
| InChI | InChI=1S/C23H32N2O3/c1-5-25(6-2)14-16-28-22-10-8-7-9-20(22)24-23(26)13-15-27-21-12-11-18(3)17-19(21)4/h7-12,17H,5-6,13-16H2,1-4H3,(H,24,26) |
| InChIKey | NLUCUZVVXWQOEQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |