C24H34N4O3 — CID 56514095
3-[[benzyl(methyl)carbamoyl]amino]-N-[2-[2-(diethylamino)ethoxy]phenyl]propanamide (PubChem CID 56514095) has the molecular formula C24H34N4O3 and a molecular weight of 426.56 g/mol. Its IUPAC name is 3-[[benzyl(methyl)carbamoyl]amino]-N-[2-[2-(diethylamino)ethoxy]phenyl]propanamide.
| Compound Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[2-[2-(diethylamino)ethoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 56514095 |
| Molecular Formula | C24H34N4O3 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[2-[2-(diethylamino)ethoxy]phenyl]propanamide |
| SMILES | CCN(CC)CCOc1ccccc1NC(=O)CCNC(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C24H34N4O3/c1-4-28(5-2)17-18-31-22-14-10-9-13-21(22)26-23(29)15-16-25-24(30)27(3)19-20-11-7-6-8-12-20/h6-14H,4-5,15-19H2,1-3H3,(H,25,30)(H,26,29) |
| InChIKey | BCSHCASUOJZPQO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |