C23H27N5O3 — CID 56540324
3-[[benzyl(methyl)carbamoyl]amino]-N-[2-(2-imidazol-1-ylethoxy)phenyl]propanamide (PubChem CID 56540324) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 3-[[benzyl(methyl)carbamoyl]amino]-N-[2-(2-imidazol-1-ylethoxy)phenyl]propanamide.
| Compound Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[2-(2-imidazol-1-ylethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 56540324 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[2-(2-imidazol-1-ylethoxy)phenyl]propanamide |
| SMILES | CN(Cc1ccccc1)C(=O)NCCC(=O)Nc1ccccc1OCCn1ccnc1 |
| InChI | InChI=1S/C23H27N5O3/c1-27(17-19-7-3-2-4-8-19)23(30)25-12-11-22(29)26-20-9-5-6-10-21(20)31-16-15-28-14-13-24-18-28/h2-10,13-14,18H,11-12,15-17H2,1H3,(H,25,30)(H,26,29) |
| InChIKey | SFHWHKUDVXKILN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |