C23H28N4O2 — CID 124721834
(2S)-2-[benzyl(methyl)amino]-N-[2-(2-imidazol-1-ylethoxy)phenyl]butanamide (PubChem CID 124721834) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is (2S)-2-[benzyl(methyl)amino]-N-[2-(2-imidazol-1-ylethoxy)phenyl]butanamide.
| Compound Name | (2S)-2-[benzyl(methyl)amino]-N-[2-(2-imidazol-1-ylethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 124721834 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (2S)-2-[benzyl(methyl)amino]-N-[2-(2-imidazol-1-ylethoxy)phenyl]butanamide |
| SMILES | CC[C@@H](C(=O)Nc1ccccc1OCCn1ccnc1)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C23H28N4O2/c1-3-21(26(2)17-19-9-5-4-6-10-19)23(28)25-20-11-7-8-12-22(20)29-16-15-27-14-13-24-18-27/h4-14,18,21H,3,15-17H2,1-2H3,(H,25,28)/t21-/m0/s1 |
| InChIKey | AIQWEHNYYOMQIG-NRFANRHFSA-N |
| XLogP | 3.81 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |