C16H16N4O2S — CID 99833540
1-[2-(2-imidazol-1-ylethoxy)phenyl]-3-thiophen-3-ylurea (PubChem CID 99833540) has the molecular formula C16H16N4O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is 1-[2-(2-imidazol-1-ylethoxy)phenyl]-3-thiophen-3-ylurea.
| Compound Name | 1-[2-(2-imidazol-1-ylethoxy)phenyl]-3-thiophen-3-ylurea |
|---|---|
| PubChem CID | 99833540 |
| Molecular Formula | C16H16N4O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 1-[2-(2-imidazol-1-ylethoxy)phenyl]-3-thiophen-3-ylurea |
| SMILES | O=C(Nc1ccsc1)Nc1ccccc1OCCn1ccnc1 |
| InChI | InChI=1S/C16H16N4O2S/c21-16(18-13-5-10-23-11-13)19-14-3-1-2-4-15(14)22-9-8-20-7-6-17-12-20/h1-7,10-12H,8-9H2,(H2,18,19,21) |
| InChIKey | NLMIMJAALROVOW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |