C18H19N3O2S — CID 47045489
N-[3-(2-imidazol-1-ylethoxy)phenyl]-3-thiophen-3-ylpropanamide (PubChem CID 47045489) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is N-[3-(2-imidazol-1-ylethoxy)phenyl]-3-thiophen-3-ylpropanamide.
| Compound Name | N-[3-(2-imidazol-1-ylethoxy)phenyl]-3-thiophen-3-ylpropanamide |
|---|---|
| PubChem CID | 47045489 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | N-[3-(2-imidazol-1-ylethoxy)phenyl]-3-thiophen-3-ylpropanamide |
| SMILES | O=C(CCc1ccsc1)Nc1cccc(OCCn2ccnc2)c1 |
| InChI | InChI=1S/C18H19N3O2S/c22-18(5-4-15-6-11-24-13-15)20-16-2-1-3-17(12-16)23-10-9-21-8-7-19-14-21/h1-3,6-8,11-14H,4-5,9-10H2,(H,20,22) |
| InChIKey | GWSJJODNUNCQCN-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |