C16H17Cl2N3O2 — CID 94613242
(1R)-2,2-dichloro-N-[3-(2-imidazol-1-ylethoxy)phenyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 94613242) has the molecular formula C16H17Cl2N3O2 and a molecular weight of 354.24 g/mol. Its IUPAC name is (1R)-2,2-dichloro-N-[3-(2-imidazol-1-ylethoxy)phenyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dichloro-N-[3-(2-imidazol-1-ylethoxy)phenyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 94613242 |
| Molecular Formula | C16H17Cl2N3O2 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | (1R)-2,2-dichloro-N-[3-(2-imidazol-1-ylethoxy)phenyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | C[C@]1(C(=O)Nc2cccc(OCCn3ccnc3)c2)CC1(Cl)Cl |
| InChI | InChI=1S/C16H17Cl2N3O2/c1-15(10-16(15,17)18)14(22)20-12-3-2-4-13(9-12)23-8-7-21-6-5-19-11-21/h2-6,9,11H,7-8,10H2,1H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | HEPAROBEHGPHMN-OAHLLOKOSA-N |
| XLogP | 3.48 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|