C15H15Cl2N3O — CID 32557435
(1R)-2,2-dichloro-N-[3-(imidazol-1-ylmethyl)phenyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 32557435) has the molecular formula C15H15Cl2N3O and a molecular weight of 324.21 g/mol. Its IUPAC name is (1R)-2,2-dichloro-N-[3-(imidazol-1-ylmethyl)phenyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dichloro-N-[3-(imidazol-1-ylmethyl)phenyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 32557435 |
| Molecular Formula | C15H15Cl2N3O |
| Molecular Weight | 324.21 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | (1R)-2,2-dichloro-N-[3-(imidazol-1-ylmethyl)phenyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | C[C@]1(C(=O)Nc2cccc(Cn3ccnc3)c2)CC1(Cl)Cl |
| InChI | InChI=1S/C15H15Cl2N3O/c1-14(9-15(14,16)17)13(21)19-12-4-2-3-11(7-12)8-20-6-5-18-10-20/h2-7,10H,8-9H2,1H3,(H,19,21)/t14-/m1/s1 |
| InChIKey | CUXKIEQIZFDUSG-CQSZACIVSA-N |
| XLogP | 3.45 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.21 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|