C19H16F3N3O — CID 166201634
4-(imidazol-1-ylmethyl)-N-[3-(2,2,2-trifluoroethyl)phenyl]benzamide (PubChem CID 166201634) has the molecular formula C19H16F3N3O and a molecular weight of 359.35 g/mol. Its IUPAC name is 4-(imidazol-1-ylmethyl)-N-[3-(2,2,2-trifluoroethyl)phenyl]benzamide.
| Compound Name | 4-(imidazol-1-ylmethyl)-N-[3-(2,2,2-trifluoroethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 166201634 |
| Molecular Formula | C19H16F3N3O |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 4-(imidazol-1-ylmethyl)-N-[3-(2,2,2-trifluoroethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(CC(F)(F)F)c1)c1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C19H16F3N3O/c20-19(21,22)11-15-2-1-3-17(10-15)24-18(26)16-6-4-14(5-7-16)12-25-9-8-23-13-25/h1-10,13H,11-12H2,(H,24,26) |
| InChIKey | UGIWZPVZTNLTQO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |