C14H13F3N2O3S — CID 154889376
N-pyridin-3-yl-3-thiophen-3-ylpropanamide;2,2,2-trifluoroacetic acid (PubChem CID 154889376) has the molecular formula C14H13F3N2O3S and a molecular weight of 346.33 g/mol. Its IUPAC name is N-pyridin-3-yl-3-thiophen-3-ylpropanamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-pyridin-3-yl-3-thiophen-3-ylpropanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 154889376 |
| Molecular Formula | C14H13F3N2O3S |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | N-pyridin-3-yl-3-thiophen-3-ylpropanamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(CCc1ccsc1)Nc1cccnc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H12N2OS.C2HF3O2/c15-12(4-3-10-5-7-16-9-10)14-11-2-1-6-13-8-11;3-2(4,5)1(6)7/h1-2,5-9H,3-4H2,(H,14,15);(H,6,7) |
| InChIKey | UVOJNWHCQFHSPF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |