C14H14F3N3O2S — CID 47789441
N-[2-(2-imidazol-1-ylethoxy)phenyl]-2-(trifluoromethylsulfanyl)acetamide (PubChem CID 47789441) has the molecular formula C14H14F3N3O2S and a molecular weight of 345.35 g/mol. Its IUPAC name is N-[2-(2-imidazol-1-ylethoxy)phenyl]-2-(trifluoromethylsulfanyl)acetamide.
| Compound Name | N-[2-(2-imidazol-1-ylethoxy)phenyl]-2-(trifluoromethylsulfanyl)acetamide |
|---|---|
| PubChem CID | 47789441 |
| Molecular Formula | C14H14F3N3O2S |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-[2-(2-imidazol-1-ylethoxy)phenyl]-2-(trifluoromethylsulfanyl)acetamide |
| SMILES | O=C(CSC(F)(F)F)Nc1ccccc1OCCn1ccnc1 |
| InChI | InChI=1S/C14H14F3N3O2S/c15-14(16,17)23-9-13(21)19-11-3-1-2-4-12(11)22-8-7-20-6-5-18-10-20/h1-6,10H,7-9H2,(H,19,21) |
| InChIKey | ACBWTHXQVMCRBZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |