C17H24Cl2N4O2 — CID 119862195
2-(cyclopropylmethylamino)-N-[2-(2-imidazol-1-ylethoxy)phenyl]acetamide;dihydrochloride (PubChem CID 119862195) has the molecular formula C17H24Cl2N4O2 and a molecular weight of 387.31 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-N-[2-(2-imidazol-1-ylethoxy)phenyl]acetamide;dihydrochloride.
| Compound Name | 2-(cyclopropylmethylamino)-N-[2-(2-imidazol-1-ylethoxy)phenyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119862195 |
| Molecular Formula | C17H24Cl2N4O2 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 2-(cyclopropylmethylamino)-N-[2-(2-imidazol-1-ylethoxy)phenyl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CNCC1CC1)Nc1ccccc1OCCn1ccnc1 |
| InChI | InChI=1S/C17H22N4O2.2ClH/c22-17(12-19-11-14-5-6-14)20-15-3-1-2-4-16(15)23-10-9-21-8-7-18-13-21;;/h1-4,7-8,13-14,19H,5-6,9-12H2,(H,20,22);2*1H |
| InChIKey | FZZGJDQEOAORPF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |