C23H38N2O4 — CID 3072629
(1-propoxy-3-pyrrolidin-1-ylpropan-2-yl) N-(3-hexoxyphenyl)carbamate (PubChem CID 3072629) has the molecular formula C23H38N2O4 and a molecular weight of 406.57 g/mol. Its IUPAC name is (1-propoxy-3-pyrrolidin-1-ylpropan-2-yl) N-(3-hexoxyphenyl)carbamate.
| Compound Name | (1-propoxy-3-pyrrolidin-1-ylpropan-2-yl) N-(3-hexoxyphenyl)carbamate |
|---|---|
| PubChem CID | 3072629 |
| Molecular Formula | C23H38N2O4 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.28 |
| IUPAC Name | (1-propoxy-3-pyrrolidin-1-ylpropan-2-yl) N-(3-hexoxyphenyl)carbamate |
| SMILES | CCCCCCOc1cccc(NC(=O)OC(COCCC)CN2CCCC2)c1 |
| InChI | InChI=1S/C23H38N2O4/c1-3-5-6-9-16-28-21-12-10-11-20(17-21)24-23(26)29-22(19-27-15-4-2)18-25-13-7-8-14-25/h10-12,17,22H,3-9,13-16,18-19H2,1-2H3,(H,24,26) |
| InChIKey | AHIGPKPQIDNBPB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|