C22H36N2O3 — CID 101362582
[(2R)-1-piperidin-1-ylpropan-2-yl] N-(4-heptoxyphenyl)carbamate (PubChem CID 101362582) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is [(2R)-1-piperidin-1-ylpropan-2-yl] N-(4-heptoxyphenyl)carbamate.
| Compound Name | [(2R)-1-piperidin-1-ylpropan-2-yl] N-(4-heptoxyphenyl)carbamate |
|---|---|
| PubChem CID | 101362582 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | [(2R)-1-piperidin-1-ylpropan-2-yl] N-(4-heptoxyphenyl)carbamate |
| SMILES | CCCCCCCOc1ccc(NC(=O)O[C@H](C)CN2CCCCC2)cc1 |
| InChI | InChI=1S/C22H36N2O3/c1-3-4-5-6-10-17-26-21-13-11-20(12-14-21)23-22(25)27-19(2)18-24-15-8-7-9-16-24/h11-14,19H,3-10,15-18H2,1-2H3,(H,23,25)/t19-/m1/s1 |
| InChIKey | DWCVBUZBVDETIW-LJQANCHMSA-N |
| XLogP | 5.46 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|