C21H34N2O2 — CID 54814498
2-(azepan-1-yl)-N-(4-heptoxyphenyl)acetamide (PubChem CID 54814498) has the molecular formula C21H34N2O2 and a molecular weight of 346.51 g/mol. Its IUPAC name is 2-(azepan-1-yl)-N-(4-heptoxyphenyl)acetamide.
| Compound Name | 2-(azepan-1-yl)-N-(4-heptoxyphenyl)acetamide |
|---|---|
| PubChem CID | 54814498 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | 2-(azepan-1-yl)-N-(4-heptoxyphenyl)acetamide |
| SMILES | CCCCCCCOc1ccc(NC(=O)CN2CCCCCC2)cc1 |
| InChI | InChI=1S/C21H34N2O2/c1-2-3-4-7-10-17-25-20-13-11-19(12-14-20)22-21(24)18-23-15-8-5-6-9-16-23/h11-14H,2-10,15-18H2,1H3,(H,22,24) |
| InChIKey | YGQPHGVBZAZOHV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|