C24H41ClN2O3 — CID 24836575
decyl N-[4-(2-piperidin-1-ylethoxy)phenyl]carbamate;hydrochloride (PubChem CID 24836575) has the molecular formula C24H41ClN2O3 and a molecular weight of 441.06 g/mol. Its IUPAC name is decyl N-[4-(2-piperidin-1-ylethoxy)phenyl]carbamate;hydrochloride.
| Compound Name | decyl N-[4-(2-piperidin-1-ylethoxy)phenyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 24836575 |
| Molecular Formula | C24H41ClN2O3 |
| Molecular Weight | 441.06 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | decyl N-[4-(2-piperidin-1-ylethoxy)phenyl]carbamate;hydrochloride |
| SMILES | CCCCCCCCCCOC(=O)Nc1ccc(OCCN2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C24H40N2O3.ClH/c1-2-3-4-5-6-7-8-12-20-29-24(27)25-22-13-15-23(16-14-22)28-21-19-26-17-10-9-11-18-26;/h13-16H,2-12,17-21H2,1H3,(H,25,27);1H |
| InChIKey | MVDVLDYWFJXQFJ-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.06 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|