C19H33ClN2O3 — CID 138399577
1-(diethylamino)propan-2-yl N-(4-pentoxyphenyl)carbamate;hydrochloride (PubChem CID 138399577) has the molecular formula C19H33ClN2O3 and a molecular weight of 372.94 g/mol. Its IUPAC name is 1-(diethylamino)propan-2-yl N-(4-pentoxyphenyl)carbamate;hydrochloride.
| Compound Name | 1-(diethylamino)propan-2-yl N-(4-pentoxyphenyl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 138399577 |
| Molecular Formula | C19H33ClN2O3 |
| Molecular Weight | 372.94 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 1-(diethylamino)propan-2-yl N-(4-pentoxyphenyl)carbamate;hydrochloride |
| SMILES | CCCCCOc1ccc(NC(=O)OC(C)CN(CC)CC)cc1.Cl |
| InChI | InChI=1S/C19H32N2O3.ClH/c1-5-8-9-14-23-18-12-10-17(11-13-18)20-19(22)24-16(4)15-21(6-2)7-3;/h10-13,16H,5-9,14-15H2,1-4H3,(H,20,22);1H |
| InChIKey | KVGGMQPUXXUKMM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.94 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|