About (propan-2-ylideneamino) N-(4-nonoxyphenyl)carbamate
(propan-2-ylideneamino) N-(4-nonoxyphenyl)carbamate (PubChem CID 20872821) has the molecular formula C19H30N2O3
and a molecular weight of 334.46 g/mol. Its IUPAC name is (propan-2-ylideneamino) N-(4-nonoxyphenyl)carbamate.
Molecular Properties
| Compound Name | (propan-2-ylideneamino) N-(4-nonoxyphenyl)carbamate |
| PubChem CID | 20872821 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (propan-2-ylideneamino) N-(4-nonoxyphenyl)carbamate |
| SMILES | CCCCCCCCCOc1ccc(NC(=O)ON=C(C)C)cc1 |
| InChI | InChI=1S/C19H30N2O3/c1-4-5-6-7-8-9-10-15-23-18-13-11-17(12-14-18)20-19(22)24-21-16(2)3/h11-14H,4-10,15H2,1-3H3,(H,20,22) |
| InChIKey | JNUCPQPMMFLJDL-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (propan-2-ylideneamino) N-(4-nonoxyphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (propan-2-ylideneamino) N-(4-nonoxyphenyl)carbamate?
The IUPAC name of (propan-2-ylideneamino) N-(4-nonoxyphenyl)carbamate (CID 20872821) is (propan-2-ylideneamino) N-(4-nonoxyphenyl)carbamate.
What is the SMILES notation for (propan-2-ylideneamino) N-(4-nonoxyphenyl)carbamate?
The canonical SMILES for (propan-2-ylideneamino) N-(4-nonoxyphenyl)carbamate is CCCCCCCCCOc1ccc(NC(=O)ON=C(C)C)cc1.
What is the InChIKey of (propan-2-ylideneamino) N-(4-nonoxyphenyl)carbamate?
The InChIKey is JNUCPQPMMFLJDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O3/c1-4-5-6-7-8-9-10-15-23-18-13-11-17(12-14-18)20-19(22)24-21-16(2)3/h11-14H,4-10,15H2,1-3H3,(H,20,22).
What are the key properties of (propan-2-ylideneamino) N-(4-nonoxyphenyl)carbamate?
(propan-2-ylideneamino) N-(4-nonoxyphenyl)carbamate has a molecular weight of 334.46 g/mol, XLogP of 5.76, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (propan-2-ylideneamino) N-(4-nonoxyphenyl)carbamate is sourced from PubChem (CID 20872821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).