C19H23N3O3 — CID 20872724
[(E)-pyridin-3-ylmethylideneamino] N-(4-hexoxyphenyl)carbamate (PubChem CID 20872724) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is [(E)-pyridin-3-ylmethylideneamino] N-(4-hexoxyphenyl)carbamate.
| Compound Name | [(E)-pyridin-3-ylmethylideneamino] N-(4-hexoxyphenyl)carbamate |
|---|---|
| PubChem CID | 20872724 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | [(E)-pyridin-3-ylmethylideneamino] N-(4-hexoxyphenyl)carbamate |
| SMILES | CCCCCCOc1ccc(NC(=O)O/N=C/c2cccnc2)cc1 |
| InChI | InChI=1S/C19H23N3O3/c1-2-3-4-5-13-24-18-10-8-17(9-11-18)22-19(23)25-21-15-16-7-6-12-20-14-16/h6-12,14-15H,2-5,13H2,1H3,(H,22,23)/b21-15+ |
| InChIKey | RMVXLSAGDWMXBQ-RCCKNPSSSA-N |
| XLogP | 4.62 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|