C23H33N3O2 — CID 5217676
1-(4-decoxyphenyl)-3-(pyridin-3-ylmethyl)urea (PubChem CID 5217676) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-(4-decoxyphenyl)-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-(4-decoxyphenyl)-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 5217676 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | 1-(4-decoxyphenyl)-3-(pyridin-3-ylmethyl)urea |
| SMILES | CCCCCCCCCCOc1ccc(NC(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C23H33N3O2/c1-2-3-4-5-6-7-8-9-17-28-22-14-12-21(13-15-22)26-23(27)25-19-20-11-10-16-24-18-20/h10-16,18H,2-9,17,19H2,1H3,(H2,25,26,27) |
| InChIKey | FVAPFRGHMQODDO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|