C28H27N3O3 — CID 123644948
1-[4-[2-[2-(3-methoxyphenyl)phenyl]ethoxy]phenyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 123644948) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is 1-[4-[2-[2-(3-methoxyphenyl)phenyl]ethoxy]phenyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[4-[2-[2-(3-methoxyphenyl)phenyl]ethoxy]phenyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 123644948 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 1-[4-[2-[2-(3-methoxyphenyl)phenyl]ethoxy]phenyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | COc1cccc(-c2ccccc2CCOc2ccc(NC(=O)NCc3cccnc3)cc2)c1 |
| InChI | InChI=1S/C28H27N3O3/c1-33-26-9-4-8-23(18-26)27-10-3-2-7-22(27)15-17-34-25-13-11-24(12-14-25)31-28(32)30-20-21-6-5-16-29-19-21/h2-14,16,18-19H,15,17,20H2,1H3,(H2,30,31,32) |
| InChIKey | HAJVQHXCCVMQFW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |