C32H33N4O6+ — CID 72944376
methyl 2-[[3-[[[4-[2-(2-phenylphenyl)ethoxy]phenyl]carbamoylamino]methyl]pyridin-1-ium-1-yl]methoxycarbonylamino]acetate (PubChem CID 72944376) has the molecular formula C32H33N4O6+ and a molecular weight of 569.64 g/mol. Its IUPAC name is methyl 2-[[3-[[[4-[2-(2-phenylphenyl)ethoxy]phenyl]carbamoylamino]methyl]pyridin-1-ium-1-yl]methoxycarbonylamino]acetate.
| Compound Name | methyl 2-[[3-[[[4-[2-(2-phenylphenyl)ethoxy]phenyl]carbamoylamino]methyl]pyridin-1-ium-1-yl]methoxycarbonylamino]acetate |
|---|---|
| PubChem CID | 72944376 |
| Molecular Formula | C32H33N4O6+ |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | methyl 2-[[3-[[[4-[2-(2-phenylphenyl)ethoxy]phenyl]carbamoylamino]methyl]pyridin-1-ium-1-yl]methoxycarbonylamino]acetate |
| SMILES | COC(=O)CNC(=O)OC[n+]1cccc(CNC(=O)Nc2ccc(OCCc3ccccc3-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C32H32N4O6/c1-40-30(37)21-34-32(39)42-23-36-18-7-8-24(22-36)20-33-31(38)35-27-13-15-28(16-14-27)41-19-17-26-11-5-6-12-29(26)25-9-3-2-4-10-25/h2-16,18,22H,17,19-21,23H2,1H3,(H2-,33,34,35,38,39)/p+1 |
| InChIKey | HISNKOVCNPTLKM-UHFFFAOYSA-O |
| XLogP | 4.44 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|