C19H25N3O3 — CID 94813696
1-benzyl-3-[4-[(2S)-3-(dimethylamino)-2-hydroxypropoxy]phenyl]urea (PubChem CID 94813696) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-benzyl-3-[4-[(2S)-3-(dimethylamino)-2-hydroxypropoxy]phenyl]urea.
| Compound Name | 1-benzyl-3-[4-[(2S)-3-(dimethylamino)-2-hydroxypropoxy]phenyl]urea |
|---|---|
| PubChem CID | 94813696 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 1-benzyl-3-[4-[(2S)-3-(dimethylamino)-2-hydroxypropoxy]phenyl]urea |
| SMILES | CN(C)C[C@H](O)COc1ccc(NC(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H25N3O3/c1-22(2)13-17(23)14-25-18-10-8-16(9-11-18)21-19(24)20-12-15-6-4-3-5-7-15/h3-11,17,23H,12-14H2,1-2H3,(H2,20,21,24)/t17-/m0/s1 |
| InChIKey | PAFPMUATDZUZKK-KRWDZBQOSA-N |
| XLogP | 2.31 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |