C20H26N2O3 — CID 110907951
N-[4-[2-hydroxy-3-(N-propan-2-ylanilino)propoxy]phenyl]acetamide (PubChem CID 110907951) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[4-[2-hydroxy-3-(N-propan-2-ylanilino)propoxy]phenyl]acetamide.
| Compound Name | N-[4-[2-hydroxy-3-(N-propan-2-ylanilino)propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 110907951 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-[4-[2-hydroxy-3-(N-propan-2-ylanilino)propoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(OCC(O)CN(c2ccccc2)C(C)C)cc1 |
| InChI | InChI=1S/C20H26N2O3/c1-15(2)22(18-7-5-4-6-8-18)13-19(24)14-25-20-11-9-17(10-12-20)21-16(3)23/h4-12,15,19,24H,13-14H2,1-3H3,(H,21,23) |
| InChIKey | PZSHJVUJCFHCAK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |