C15H21N5O3 — CID 47085454
1-[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-3-(1H-pyrazol-4-yl)urea (PubChem CID 47085454) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is 1-[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-3-(1H-pyrazol-4-yl)urea.
| Compound Name | 1-[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-3-(1H-pyrazol-4-yl)urea |
|---|---|
| PubChem CID | 47085454 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 1-[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-3-(1H-pyrazol-4-yl)urea |
| SMILES | CN(C)CC(O)COc1ccc(NC(=O)Nc2cn[nH]c2)cc1 |
| InChI | InChI=1S/C15H21N5O3/c1-20(2)9-13(21)10-23-14-5-3-11(4-6-14)18-15(22)19-12-7-16-17-8-12/h3-8,13,21H,9-10H2,1-2H3,(H,16,17)(H2,18,19,22) |
| InChIKey | ZTHISJFHUZKZHJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 102.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |