C16H20ClN3O3 — CID 71914612
4-chloro-N-[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-1H-pyrrole-2-carboxamide (PubChem CID 71914612) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is 4-chloro-N-[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 71914612 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 4-chloro-N-[4-[3-(dimethylamino)-2-hydroxypropoxy]phenyl]-1H-pyrrole-2-carboxamide |
| SMILES | CN(C)CC(O)COc1ccc(NC(=O)c2cc(Cl)c[nH]2)cc1 |
| InChI | InChI=1S/C16H20ClN3O3/c1-20(2)9-13(21)10-23-14-5-3-12(4-6-14)19-16(22)15-7-11(17)8-18-15/h3-8,13,18,21H,9-10H2,1-2H3,(H,19,22) |
| InChIKey | LUAQWDUIGYICSI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |