C18H21ClN2O3 — CID 110888444
2-[[3-(4-chlorophenoxy)-2-hydroxypropyl]-methylamino]-N-phenylacetamide (PubChem CID 110888444) has the molecular formula C18H21ClN2O3 and a molecular weight of 348.83 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenoxy)-2-hydroxypropyl]-methylamino]-N-phenylacetamide.
| Compound Name | 2-[[3-(4-chlorophenoxy)-2-hydroxypropyl]-methylamino]-N-phenylacetamide |
|---|---|
| PubChem CID | 110888444 |
| Molecular Formula | C18H21ClN2O3 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-[[3-(4-chlorophenoxy)-2-hydroxypropyl]-methylamino]-N-phenylacetamide |
| SMILES | CN(CC(=O)Nc1ccccc1)CC(O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H21ClN2O3/c1-21(12-18(23)20-15-5-3-2-4-6-15)11-16(22)13-24-17-9-7-14(19)8-10-17/h2-10,16,22H,11-13H2,1H3,(H,20,23) |
| InChIKey | OTCVQGZQPBIUIP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |