C18H20ClNO4 — CID 12801053
methyl 2-(N-[3-(4-chlorophenoxy)-2-hydroxypropyl]anilino)acetate (PubChem CID 12801053) has the molecular formula C18H20ClNO4 and a molecular weight of 349.81 g/mol. Its IUPAC name is methyl 2-(N-[3-(4-chlorophenoxy)-2-hydroxypropyl]anilino)acetate.
| Compound Name | methyl 2-(N-[3-(4-chlorophenoxy)-2-hydroxypropyl]anilino)acetate |
|---|---|
| PubChem CID | 12801053 |
| Molecular Formula | C18H20ClNO4 |
| Molecular Weight | 349.81 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | methyl 2-(N-[3-(4-chlorophenoxy)-2-hydroxypropyl]anilino)acetate |
| SMILES | COC(=O)CN(CC(O)COc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H20ClNO4/c1-23-18(22)12-20(15-5-3-2-4-6-15)11-16(21)13-24-17-9-7-14(19)8-10-17/h2-10,16,21H,11-13H2,1H3 |
| InChIKey | AYXNGUUHECRFML-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.81 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |