C42H48N2O8 — CID 99654291
(2S)-1-[4-[bis[(2R)-2-hydroxy-3-phenoxypropyl]amino]-N-[(2S)-2-hydroxy-3-phenoxypropyl]anilino]-3-phenoxypropan-2-ol (PubChem CID 99654291) has the molecular formula C42H48N2O8 and a molecular weight of 708.85 g/mol. Its IUPAC name is (2S)-1-[4-[bis[(2R)-2-hydroxy-3-phenoxypropyl]amino]-N-[(2S)-2-hydroxy-3-phenoxypropyl]anilino]-3-phenoxypropan-2-ol.
| Compound Name | (2S)-1-[4-[bis[(2R)-2-hydroxy-3-phenoxypropyl]amino]-N-[(2S)-2-hydroxy-3-phenoxypropyl]anilino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 99654291 |
| Molecular Formula | C42H48N2O8 |
| Molecular Weight | 708.85 g/mol |
| Exact Mass | 708.34 |
| IUPAC Name | (2S)-1-[4-[bis[(2R)-2-hydroxy-3-phenoxypropyl]amino]-N-[(2S)-2-hydroxy-3-phenoxypropyl]anilino]-3-phenoxypropan-2-ol |
| SMILES | O[C@H](COc1ccccc1)CN(C[C@H](O)COc1ccccc1)c1ccc(N(C[C@@H](O)COc2ccccc2)C[C@@H](O)COc2ccccc2)cc1 |
| InChI | InChI=1S/C42H48N2O8/c45-35(29-49-39-13-5-1-6-14-39)25-43(26-36(46)30-50-40-15-7-2-8-16-40)33-21-23-34(24-22-33)44(27-37(47)31-51-41-17-9-3-10-18-41)28-38(48)32-52-42-19-11-4-12-20-42/h1-24,35-38,45-48H,25-32H2/t35-,36-,37+,38+ |
| InChIKey | ZDBQEFLWRHRBJL-MYYWMFIASA-N |
| XLogP | 5.06 |
| TPSA | 124.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.85 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|