C20H26ClNO4 — CID 138959431
1-[4-[2-hydroxy-3-[N-(2-hydroxyethyl)anilino]propoxy]phenyl]propan-1-one;hydrochloride (PubChem CID 138959431) has the molecular formula C20H26ClNO4 and a molecular weight of 379.88 g/mol. Its IUPAC name is 1-[4-[2-hydroxy-3-[N-(2-hydroxyethyl)anilino]propoxy]phenyl]propan-1-one;hydrochloride.
| Compound Name | 1-[4-[2-hydroxy-3-[N-(2-hydroxyethyl)anilino]propoxy]phenyl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 138959431 |
| Molecular Formula | C20H26ClNO4 |
| Molecular Weight | 379.88 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 1-[4-[2-hydroxy-3-[N-(2-hydroxyethyl)anilino]propoxy]phenyl]propan-1-one;hydrochloride |
| SMILES | CCC(=O)c1ccc(OCC(O)CN(CCO)c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C20H25NO4.ClH/c1-2-20(24)16-8-10-19(11-9-16)25-15-18(23)14-21(12-13-22)17-6-4-3-5-7-17;/h3-11,18,22-23H,2,12-15H2,1H3;1H |
| InChIKey | UTFFUTIBZNMGLO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.88 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |