C27H26N2O5 — CID 55410388
3-[2-hydroxy-3-(4-propanoylphenoxy)propyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 55410388) has the molecular formula C27H26N2O5 and a molecular weight of 458.51 g/mol. Its IUPAC name is 3-[2-hydroxy-3-(4-propanoylphenoxy)propyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[2-hydroxy-3-(4-propanoylphenoxy)propyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55410388 |
| Molecular Formula | C27H26N2O5 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 3-[2-hydroxy-3-(4-propanoylphenoxy)propyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | CCC(=O)c1ccc(OCC(O)CN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C27H26N2O5/c1-2-24(31)19-13-15-23(16-14-19)34-18-22(30)17-29-25(32)27(28-26(29)33,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16,22,30H,2,17-18H2,1H3,(H,28,33) |
| InChIKey | XOJHCANKSOZRIZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|