C19H18N2O3 — CID 51108463
3-(2-oxobutyl)-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 51108463) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-(2-oxobutyl)-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-(2-oxobutyl)-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51108463 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 3-(2-oxobutyl)-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | CCC(=O)CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H18N2O3/c1-2-16(22)13-21-17(23)19(20-18(21)24,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3,(H,20,24) |
| InChIKey | GLAZEKDZSWLPRA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|